About (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate
(1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate (PubChem CID 15636668) has the molecular formula C22H27NO3
and a molecular weight of 353.46 g/mol. Its IUPAC name is (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate.
Molecular Properties
| Compound Name | (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate |
| PubChem CID | 15636668 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate |
| SMILES | CCCN1CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27NO3/c1-2-15-23-16-13-20(14-17-23)26-21(24)22(25,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,20,25H,2,13-17H2,1H3 |
| InChIKey | SBFXCSQKDQEOCY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
The IUPAC name of (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate (CID 15636668) is (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate.
What is the SMILES notation for (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
The canonical SMILES for (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate is CCCN1CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
The InChIKey is SBFXCSQKDQEOCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3/c1-2-15-23-16-13-20(14-17-23)26-21(24)22(25,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,20,25H,2,13-17H2,1H3.
What are the key properties of (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
(1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate has a molecular weight of 353.46 g/mol, XLogP of 3.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate is sourced from PubChem (CID 15636668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).