About N'-cyano-N,N-dimethylethanimidamide
N'-cyano-N,N-dimethylethanimidamide (PubChem CID 15637835) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is N'-cyano-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-cyano-N,N-dimethylethanimidamide |
| PubChem CID | 15637835 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | N'-cyano-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\C#N)N(C)C |
| InChI | InChI=1S/C5H9N3/c1-5(7-4-6)8(2)3/h1-3H3/b7-5+ |
| InChIKey | YEEMHJNIVXNCSN-FNORWQNLSA-N |
| XLogP | 0.45 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyano-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyano-N,N-dimethylethanimidamide?
The IUPAC name of N'-cyano-N,N-dimethylethanimidamide (CID 15637835) is N'-cyano-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-cyano-N,N-dimethylethanimidamide?
The canonical SMILES for N'-cyano-N,N-dimethylethanimidamide is C/C(=N\C#N)N(C)C.
What is the InChIKey of N'-cyano-N,N-dimethylethanimidamide?
The InChIKey is YEEMHJNIVXNCSN-FNORWQNLSA-N. The full InChI is InChI=1S/C5H9N3/c1-5(7-4-6)8(2)3/h1-3H3/b7-5+.
What are the key properties of N'-cyano-N,N-dimethylethanimidamide?
N'-cyano-N,N-dimethylethanimidamide has a molecular weight of 111.15 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyano-N,N-dimethylethanimidamide is sourced from PubChem (CID 15637835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).