About spiro[4.6]undecan-10-one
spiro[4.6]undecan-10-one (PubChem CID 15638085) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is spiro[4.6]undecan-10-one.
Molecular Properties
| Compound Name | spiro[4.6]undecan-10-one |
| PubChem CID | 15638085 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | spiro[4.6]undecan-10-one |
| SMILES | O=C1CCCCC2(CCCC2)C1 |
| InChI | InChI=1S/C11H18O/c12-10-5-1-2-6-11(9-10)7-3-4-8-11/h1-9H2 |
| InChIKey | SFTTVBAYTMGRTR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[4.6]undecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.6]undecan-10-one?
The IUPAC name of spiro[4.6]undecan-10-one (CID 15638085) is spiro[4.6]undecan-10-one.
What is the SMILES notation for spiro[4.6]undecan-10-one?
The canonical SMILES for spiro[4.6]undecan-10-one is O=C1CCCCC2(CCCC2)C1.
What is the InChIKey of spiro[4.6]undecan-10-one?
The InChIKey is SFTTVBAYTMGRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c12-10-5-1-2-6-11(9-10)7-3-4-8-11/h1-9H2.
What are the key properties of spiro[4.6]undecan-10-one?
spiro[4.6]undecan-10-one has a molecular weight of 166.26 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.6]undecan-10-one is sourced from PubChem (CID 15638085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).