About 7-azatricyclo[4.3.1.03,7]decan-9-one
7-azatricyclo[4.3.1.03,7]decan-9-one (PubChem CID 15639106) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 7-azatricyclo[4.3.1.03,7]decan-9-one.
Molecular Properties
| Compound Name | 7-azatricyclo[4.3.1.03,7]decan-9-one |
| PubChem CID | 15639106 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 7-azatricyclo[4.3.1.03,7]decan-9-one |
| SMILES | O=C1CN2C3CCC2CC1C3 |
| InChI | InChI=1S/C9H13NO/c11-9-5-10-7-1-2-8(10)4-6(9)3-7/h6-8H,1-5H2 |
| InChIKey | UWOZSUJRZUMVQS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-azatricyclo[4.3.1.03,7]decan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azatricyclo[4.3.1.03,7]decan-9-one?
The IUPAC name of 7-azatricyclo[4.3.1.03,7]decan-9-one (CID 15639106) is 7-azatricyclo[4.3.1.03,7]decan-9-one.
What is the SMILES notation for 7-azatricyclo[4.3.1.03,7]decan-9-one?
The canonical SMILES for 7-azatricyclo[4.3.1.03,7]decan-9-one is O=C1CN2C3CCC2CC1C3.
What is the InChIKey of 7-azatricyclo[4.3.1.03,7]decan-9-one?
The InChIKey is UWOZSUJRZUMVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c11-9-5-10-7-1-2-8(10)4-6(9)3-7/h6-8H,1-5H2.
What are the key properties of 7-azatricyclo[4.3.1.03,7]decan-9-one?
7-azatricyclo[4.3.1.03,7]decan-9-one has a molecular weight of 151.21 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azatricyclo[4.3.1.03,7]decan-9-one is sourced from PubChem (CID 15639106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).