C11H9F3N2O — CID 156409659
8-Ethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 156409659) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 8-ethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 8-Ethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 156409659 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 8-ethyl-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCC1=CC2=NC(=CC(=O)N2C=C1)C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O/c1-2-7-3-4-16-9(5-7)15-8(6-10(16)17)11(12,13)14/h3-6H,2H2,1H3 |
| InChIKey | YKJSZZOFKRCCBF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | 483 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |