About [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol
[5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol (PubChem CID 15641499) has the molecular formula C6H9IO2S3
and a molecular weight of 336.24 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol |
| PubChem CID | 15641499 |
| Molecular Formula | C6H9IO2S3 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.88 |
| IUPAC Name | [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol |
| SMILES | CSC1(I)SC(CO)=C(CO)S1 |
| InChI | InChI=1S/C6H9IO2S3/c1-10-6(7)11-4(2-8)5(3-9)12-6/h8-9H,2-3H2,1H3 |
| InChIKey | PVODHAZFPGTQAQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol (CID 15641499) is [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol is CSC1(I)SC(CO)=C(CO)S1.
What is the InChIKey of [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol?
The InChIKey is PVODHAZFPGTQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IO2S3/c1-10-6(7)11-4(2-8)5(3-9)12-6/h8-9H,2-3H2,1H3.
What are the key properties of [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol?
[5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol has a molecular weight of 336.24 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-2-iodo-2-methylsulfanyl-1,3-dithiol-4-yl]methanol is sourced from PubChem (CID 15641499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).