C24H44O6 — CID 15642146
2,5-dicyclohexyl-1,4,7,10,13,16-hexaoxacyclooctadecane (PubChem CID 15642146) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is 2,5-dicyclohexyl-1,4,7,10,13,16-hexaoxacyclooctadecane.
| Compound Name | 2,5-dicyclohexyl-1,4,7,10,13,16-hexaoxacyclooctadecane |
|---|---|
| PubChem CID | 15642146 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 2,5-dicyclohexyl-1,4,7,10,13,16-hexaoxacyclooctadecane |
| SMILES | C1CCC(C2COCCOCCOCCOCCOC(C3CCCCC3)CO2)CC1 |
| InChI | InChI=1S/C24H44O6/c1-3-7-21(8-4-1)23-19-28-16-15-26-12-11-25-13-14-27-17-18-29-24(20-30-23)22-9-5-2-6-10-22/h21-24H,1-20H2 |
| InChIKey | DTCOOGWAKGIUQB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |