C18H34O4Si2 — CID 15642288
(6R,8R,11R)-8,11-bis(trimethylsilyloxymethyl)-2-oxaspiro[5.5]undec-9-en-1-one (PubChem CID 15642288) has the molecular formula C18H34O4Si2 and a molecular weight of 370.64 g/mol. Its IUPAC name is (6R,8R,11R)-8,11-bis(trimethylsilyloxymethyl)-2-oxaspiro[5.5]undec-9-en-1-one.
| Compound Name | (6R,8R,11R)-8,11-bis(trimethylsilyloxymethyl)-2-oxaspiro[5.5]undec-9-en-1-one |
|---|---|
| PubChem CID | 15642288 |
| Molecular Formula | C18H34O4Si2 |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (6R,8R,11R)-8,11-bis(trimethylsilyloxymethyl)-2-oxaspiro[5.5]undec-9-en-1-one |
| SMILES | C[Si](C)(C)OC[C@H]1C=C[C@@H](CO[Si](C)(C)C)[C@@]2(CCCOC2=O)C1 |
| InChI | InChI=1S/C18H34O4Si2/c1-23(2,3)21-13-15-8-9-16(14-22-24(4,5)6)18(12-15)10-7-11-20-17(18)19/h8-9,15-16H,7,10-14H2,1-6H3/t15-,16-,18+/m0/s1 |
| InChIKey | MCUVKBGGWZVMBJ-XYJFISCASA-N |
| XLogP | 4.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|