C23H46O3Sn — CID 15642395
[(E,4S)-4-hydroxy-6-tributylstannylhex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 15642395) has the molecular formula C23H46O3Sn and a molecular weight of 489.33 g/mol. Its IUPAC name is [(E,4S)-4-hydroxy-6-tributylstannylhex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,4S)-4-hydroxy-6-tributylstannylhex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15642395 |
| Molecular Formula | C23H46O3Sn |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [(E,4S)-4-hydroxy-6-tributylstannylhex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | CCCC[Sn](/C=C/[C@@H](O)CCCOC(=O)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C11H19O3.3C4H9.Sn/c1-5-9(12)7-6-8-14-10(13)11(2,3)4;3*1-3-4-2;/h1,5,9,12H,6-8H2,2-4H3;3*1,3-4H2,2H3;/t9-;;;;/m1..../s1 |
| InChIKey | JFHBCYBEBHLZDP-RASHCQHBSA-N |
| XLogP | 6.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|