About (7Z)-cyclododec-7-ene-1,2-dione
(7Z)-cyclododec-7-ene-1,2-dione (PubChem CID 15642693) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (7Z)-cyclododec-7-ene-1,2-dione.
Molecular Properties
| Compound Name | (7Z)-cyclododec-7-ene-1,2-dione |
| PubChem CID | 15642693 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (7Z)-cyclododec-7-ene-1,2-dione |
| SMILES | O=C1CCCC/C=C\CCCCC1=O |
| InChI | InChI=1S/C12H18O2/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h1-2H,3-10H2/b2-1- |
| InChIKey | OTYFUYSONWZNHW-UPHRSURJSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-cyclododec-7-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-cyclododec-7-ene-1,2-dione?
The IUPAC name of (7Z)-cyclododec-7-ene-1,2-dione (CID 15642693) is (7Z)-cyclododec-7-ene-1,2-dione.
What is the SMILES notation for (7Z)-cyclododec-7-ene-1,2-dione?
The canonical SMILES for (7Z)-cyclododec-7-ene-1,2-dione is O=C1CCCC/C=C\CCCCC1=O.
What is the InChIKey of (7Z)-cyclododec-7-ene-1,2-dione?
The InChIKey is OTYFUYSONWZNHW-UPHRSURJSA-N. The full InChI is InChI=1S/C12H18O2/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h1-2H,3-10H2/b2-1-.
What are the key properties of (7Z)-cyclododec-7-ene-1,2-dione?
(7Z)-cyclododec-7-ene-1,2-dione has a molecular weight of 194.27 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-cyclododec-7-ene-1,2-dione is sourced from PubChem (CID 15642693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).