About 1-butyl-4-ethylimidazole
1-butyl-4-ethylimidazole (PubChem CID 15643148) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-butyl-4-ethylimidazole.
Molecular Properties
| Compound Name | 1-butyl-4-ethylimidazole |
| PubChem CID | 15643148 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-butyl-4-ethylimidazole |
| SMILES | CCCCn1cnc(CC)c1 |
| InChI | InChI=1S/C9H16N2/c1-3-5-6-11-7-9(4-2)10-8-11/h7-8H,3-6H2,1-2H3 |
| InChIKey | RUPYGFPIGXHWLC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-4-ethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-ethylimidazole?
The IUPAC name of 1-butyl-4-ethylimidazole (CID 15643148) is 1-butyl-4-ethylimidazole.
What is the SMILES notation for 1-butyl-4-ethylimidazole?
The canonical SMILES for 1-butyl-4-ethylimidazole is CCCCn1cnc(CC)c1.
What is the InChIKey of 1-butyl-4-ethylimidazole?
The InChIKey is RUPYGFPIGXHWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-5-6-11-7-9(4-2)10-8-11/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-butyl-4-ethylimidazole?
1-butyl-4-ethylimidazole has a molecular weight of 152.24 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-ethylimidazole is sourced from PubChem (CID 15643148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).