About 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one
5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one (PubChem CID 15643884) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one |
| PubChem CID | 15643884 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one |
| SMILES | CC1(C)CC(=O)c2sccc2O1 |
| InChI | InChI=1S/C9H10O2S/c1-9(2)5-6(10)8-7(11-9)3-4-12-8/h3-4H,5H2,1-2H3 |
| InChIKey | NGCQGLVSMGNFAB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one?
The IUPAC name of 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one (CID 15643884) is 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one.
What is the SMILES notation for 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one?
The canonical SMILES for 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one is CC1(C)CC(=O)c2sccc2O1.
What is the InChIKey of 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one?
The InChIKey is NGCQGLVSMGNFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-9(2)5-6(10)8-7(11-9)3-4-12-8/h3-4H,5H2,1-2H3.
What are the key properties of 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one?
5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one has a molecular weight of 182.24 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6H-thieno[3,2-b]pyran-7-one is sourced from PubChem (CID 15643884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).