About 5-nitro-1-tritylindazole
5-nitro-1-tritylindazole (PubChem CID 15644404) has the molecular formula C26H19N3O2
and a molecular weight of 405.46 g/mol. Its IUPAC name is 5-nitro-1-tritylindazole.
Molecular Properties
| Compound Name | 5-nitro-1-tritylindazole |
| PubChem CID | 15644404 |
| Molecular Formula | C26H19N3O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 5-nitro-1-tritylindazole |
| SMILES | O=[N+]([O-])c1ccc2c(cnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H19N3O2/c30-29(31)24-16-17-25-20(18-24)19-27-28(25)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19H |
| InChIKey | OYAIDSBLAOETSS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1-tritylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1-tritylindazole?
The IUPAC name of 5-nitro-1-tritylindazole (CID 15644404) is 5-nitro-1-tritylindazole.
What is the SMILES notation for 5-nitro-1-tritylindazole?
The canonical SMILES for 5-nitro-1-tritylindazole is O=[N+]([O-])c1ccc2c(cnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 5-nitro-1-tritylindazole?
The InChIKey is OYAIDSBLAOETSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19N3O2/c30-29(31)24-16-17-25-20(18-24)19-27-28(25)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19H.
What are the key properties of 5-nitro-1-tritylindazole?
5-nitro-1-tritylindazole has a molecular weight of 405.46 g/mol, XLogP of 5.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1-tritylindazole is sourced from PubChem (CID 15644404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).