C7H11N3S2 — CID 15644801
6-butyl-1H-1,3,5-triazine-2,4-dithione (PubChem CID 15644801) has the molecular formula C7H11N3S2 and a molecular weight of 201.32 g/mol. Its IUPAC name is 6-butyl-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-butyl-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 15644801 |
| Molecular Formula | C7H11N3S2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 6-butyl-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCCCc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C7H11N3S2/c1-2-3-4-5-8-6(11)10-7(12)9-5/h2-4H2,1H3,(H2,8,9,10,11,12) |
| InChIKey | JKSVNWNIOHNKRK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|