C8H16N2O — CID 15644941
(3aR,6aR)-5-ethyl-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole (PubChem CID 15644941) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (3aR,6aR)-5-ethyl-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole.
| Compound Name | (3aR,6aR)-5-ethyl-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 15644941 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3aR,6aR)-5-ethyl-3a-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c][1,2]oxazole |
| SMILES | CCN1C[C@@H]2NOC[C@]2(C)C1 |
| InChI | InChI=1S/C8H16N2O/c1-3-10-4-7-8(2,5-10)6-11-9-7/h7,9H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | NJIJEWQMRVGOQK-YUMQZZPRSA-N |
| XLogP | 0.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |