C15H21NO2 — CID 15645423
[8-methoxy-2-(prop-2-enylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol (PubChem CID 15645423) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is [8-methoxy-2-(prop-2-enylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol.
| Compound Name | [8-methoxy-2-(prop-2-enylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 15645423 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | [8-methoxy-2-(prop-2-enylamino)-1,2,3,4-tetrahydronaphthalen-1-yl]methanol |
| SMILES | C=CCNC1CCc2cccc(OC)c2C1CO |
| InChI | InChI=1S/C15H21NO2/c1-3-9-16-13-8-7-11-5-4-6-14(18-2)15(11)12(13)10-17/h3-6,12-13,16-17H,1,7-10H2,2H3 |
| InChIKey | KXAPNAIRVGHCCW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|