C20H25Cl2N3O3 — CID 15645974
methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(3,6-dihydro-2H-pyridin-1-ylmethyl)piperazine-1-carboxylate (PubChem CID 15645974) has the molecular formula C20H25Cl2N3O3 and a molecular weight of 426.34 g/mol. Its IUPAC name is methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(3,6-dihydro-2H-pyridin-1-ylmethyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(3,6-dihydro-2H-pyridin-1-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 15645974 |
| Molecular Formula | C20H25Cl2N3O3 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(3,6-dihydro-2H-pyridin-1-ylmethyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)C(CN2CC=CCC2)C1 |
| InChI | InChI=1S/C20H25Cl2N3O3/c1-28-20(27)24-9-10-25(16(14-24)13-23-7-3-2-4-8-23)19(26)12-15-5-6-17(21)18(22)11-15/h2-3,5-6,11,16H,4,7-10,12-14H2,1H3 |
| InChIKey | NKZSMSGDVPNCJH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|