About 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol
2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol (PubChem CID 15646044) has the molecular formula C4H9N5O
and a molecular weight of 143.15 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol |
| PubChem CID | 15646044 |
| Molecular Formula | C4H9N5O |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol |
| SMILES | Nc1nc(NCCO)n[nH]1 |
| InChI | InChI=1S/C4H9N5O/c5-3-7-4(9-8-3)6-1-2-10/h10H,1-2H2,(H4,5,6,7,8,9) |
| InChIKey | DWDAHUISFBDIKL-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol?
The IUPAC name of 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol (CID 15646044) is 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol.
What is the SMILES notation for 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol?
The canonical SMILES for 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol is Nc1nc(NCCO)n[nH]1.
What is the InChIKey of 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol?
The InChIKey is DWDAHUISFBDIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5O/c5-3-7-4(9-8-3)6-1-2-10/h10H,1-2H2,(H4,5,6,7,8,9).
What are the key properties of 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol?
2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol has a molecular weight of 143.15 g/mol, XLogP of -1.21, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethanol is sourced from PubChem (CID 15646044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).