C24H25FN2O — CID 15646155
1-(4-fluorophenyl)-4-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)butan-1-one (PubChem CID 15646155) has the molecular formula C24H25FN2O and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)butan-1-one |
|---|---|
| PubChem CID | 15646155 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)butan-1-one |
| SMILES | Cn1c2c(c3ccccc31)C1CCC(C2)N1CCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FN2O/c1-26-20-6-3-2-5-19(20)24-21-13-12-18(15-22(24)26)27(21)14-4-7-23(28)16-8-10-17(25)11-9-16/h2-3,5-6,8-11,18,21H,4,7,12-15H2,1H3 |
| InChIKey | NMLUMLDZLGGLOV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|