C21H22N2OS — CID 15646159
4-(9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)-1-thiophen-2-ylbutan-1-one (PubChem CID 15646159) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 4-(9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 15646159 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-(9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl)-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCN1C2CCC1c1c([nH]c3ccccc13)C2)c1cccs1 |
| InChI | InChI=1S/C21H22N2OS/c24-19(20-8-4-12-25-20)7-3-11-23-14-9-10-18(23)21-15-5-1-2-6-16(15)22-17(21)13-14/h1-2,4-6,8,12,14,18,22H,3,7,9-11,13H2 |
| InChIKey | GZLRSKHJKSOBOU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|