About N,N-diethylethanamine;ethanethiol
N,N-diethylethanamine;ethanethiol (PubChem CID 15646907) has the molecular formula C8H21NS
and a molecular weight of 163.33 g/mol. Its IUPAC name is N,N-diethylethanamine;ethanethiol.
Molecular Properties
| Compound Name | N,N-diethylethanamine;ethanethiol |
| PubChem CID | 15646907 |
| Molecular Formula | C8H21NS |
| Molecular Weight | 163.33 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N,N-diethylethanamine;ethanethiol |
| SMILES | CCN(CC)CC.CCS |
| InChI | InChI=1S/C6H15N.C2H6S/c1-4-7(5-2)6-3;1-2-3/h4-6H2,1-3H3;3H,2H2,1H3 |
| InChIKey | PCYOFQMJZBKBMI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;ethanethiol?
The IUPAC name of N,N-diethylethanamine;ethanethiol (CID 15646907) is N,N-diethylethanamine;ethanethiol.
What is the SMILES notation for N,N-diethylethanamine;ethanethiol?
The canonical SMILES for N,N-diethylethanamine;ethanethiol is CCN(CC)CC.CCS.
What is the InChIKey of N,N-diethylethanamine;ethanethiol?
The InChIKey is PCYOFQMJZBKBMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H6S/c1-4-7(5-2)6-3;1-2-3/h4-6H2,1-3H3;3H,2H2,1H3.
What are the key properties of N,N-diethylethanamine;ethanethiol?
N,N-diethylethanamine;ethanethiol has a molecular weight of 163.33 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;ethanethiol is sourced from PubChem (CID 15646907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).