C13H22BrNO2 — CID 15647143
1-(2-bromo-3,3-dimethylbutyl)-4,4-dimethylpiperidine-2,6-dione (PubChem CID 15647143) has the molecular formula C13H22BrNO2 and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-(2-bromo-3,3-dimethylbutyl)-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-(2-bromo-3,3-dimethylbutyl)-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 15647143 |
| Molecular Formula | C13H22BrNO2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-(2-bromo-3,3-dimethylbutyl)-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(CC(Br)C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C13H22BrNO2/c1-12(2,3)9(14)8-15-10(16)6-13(4,5)7-11(15)17/h9H,6-8H2,1-5H3 |
| InChIKey | OVRJWLBXRJZQCE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|