C14H20O5 — CID 15647195
diethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate (PubChem CID 15647195) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is diethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 15647195 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | diethyl 5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2CC(=O)CC2C1 |
| InChI | InChI=1S/C14H20O5/c1-3-18-12(16)14(13(17)19-4-2)7-9-5-11(15)6-10(9)8-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | FLOJMAGXSICFDV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|