C10H14O4 — CID 15647458
(4S,5R)-5-[(1R)-1-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 15647458) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (4S,5R)-5-[(1R)-1-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5R)-5-[(1R)-1-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 15647458 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (4S,5R)-5-[(1R)-1-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | C#CC[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C10H14O4/c1-4-5-7(12)9-8(6-11)13-10(2,3)14-9/h1,6-9,12H,5H2,2-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | WBULUYKSAICSOR-IWSPIJDZSA-N |
| XLogP | 0.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|