C7H16N4S — CID 15647629
4-(dimethylamino)-2,5,5-trimethyl-1,2,4-triazolidine-3-thione (PubChem CID 15647629) has the molecular formula C7H16N4S and a molecular weight of 188.30 g/mol. Its IUPAC name is 4-(dimethylamino)-2,5,5-trimethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 4-(dimethylamino)-2,5,5-trimethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 15647629 |
| Molecular Formula | C7H16N4S |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-(dimethylamino)-2,5,5-trimethyl-1,2,4-triazolidine-3-thione |
| SMILES | CN1NC(C)(C)N(N(C)C)C1=S |
| InChI | InChI=1S/C7H16N4S/c1-7(2)8-10(5)6(12)11(7)9(3)4/h8H,1-5H3 |
| InChIKey | CLIMCROYQMAESX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|