C11H12N2O2 — CID 15649433
1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 15649433) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 15649433 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1,4-dimethyl-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CN1CC(=O)N(C)c2ccccc2C1=O |
| InChI | InChI=1S/C11H12N2O2/c1-12-7-10(14)13(2)9-6-4-3-5-8(9)11(12)15/h3-6H,7H2,1-2H3 |
| InChIKey | KEWVNNQQTVFTIW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |