C15H25NO5 — CID 15649457
3-O-ethyl 2-O-methyl 6-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 15649457) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 6-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 6-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15649457 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 6-(hydroxymethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC2CC(CO)CCC2CN1C(=O)OC |
| InChI | InChI=1S/C15H25NO5/c1-3-21-14(18)13-7-12-6-10(9-17)4-5-11(12)8-16(13)15(19)20-2/h10-13,17H,3-9H2,1-2H3 |
| InChIKey | NOFGNXFKVUJDOY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |