C18H23NO3 — CID 15649947
methyl 6,6-dimethyl-2-oxo-4-(2-phenylethylamino)cyclohex-3-ene-1-carboxylate (PubChem CID 15649947) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 6,6-dimethyl-2-oxo-4-(2-phenylethylamino)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 6,6-dimethyl-2-oxo-4-(2-phenylethylamino)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15649947 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl 6,6-dimethyl-2-oxo-4-(2-phenylethylamino)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C=C(NCCc2ccccc2)CC1(C)C |
| InChI | InChI=1S/C18H23NO3/c1-18(2)12-14(11-15(20)16(18)17(21)22-3)19-10-9-13-7-5-4-6-8-13/h4-8,11,16,19H,9-10,12H2,1-3H3 |
| InChIKey | ZYCZKCYCAHTTRW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|