C13H17NO2 — CID 15650003
N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 15650003) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 15650003 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | COc1cccc2c1CCC(NC(C)=O)C2 |
| InChI | InChI=1S/C13H17NO2/c1-9(15)14-11-6-7-12-10(8-11)4-3-5-13(12)16-2/h3-5,11H,6-8H2,1-2H3,(H,14,15) |
| InChIKey | HVKVUHPYXTYWNH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |