C23H26N6O3 — CID 156500262
(E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-3-[(2R,3S)-3-amino-2-methyl-4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl]-N-methylprop-2-enamide (PubChem CID 156500262) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is (E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-3-[(2R,3S)-3-amino-2-methyl-4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-3-[(2R,3S)-3-amino-2-methyl-4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 156500262 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-3-[(2R,3S)-3-amino-2-methyl-4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl]-N-methylprop-2-enamide |
| SMILES | Cc1oc2c(N)cccc2c1CN(C)C(=O)/C=C/c1cnc2c(c1)N[C@H](C)[C@H](N)C(=O)N2 |
| InChI | InChI=1S/C23H26N6O3/c1-12-20(25)23(31)28-22-18(27-12)9-14(10-26-22)7-8-19(30)29(3)11-16-13(2)32-21-15(16)5-4-6-17(21)24/h4-10,12,20,27H,11,24-25H2,1-3H3,(H,26,28,31)/b8-7+/t12-,20+/m1/s1 |
| InChIKey | JKEAIDRNDJHWBI-IGHNWBDASA-N |
| XLogP | 2.47 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|