C9H8BrIN2O — CID 156500271
3-bromo-7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one (PubChem CID 156500271) has the molecular formula C9H8BrIN2O and a molecular weight of 366.98 g/mol. Its IUPAC name is 3-bromo-7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one.
| Compound Name | 3-bromo-7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 156500271 |
| Molecular Formula | C9H8BrIN2O |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 365.89 |
| IUPAC Name | 3-bromo-7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
| SMILES | O=C1Nc2ncc(Br)cc2CCC1I |
| InChI | InChI=1S/C9H8BrIN2O/c10-6-3-5-1-2-7(11)9(14)13-8(5)12-4-6/h3-4,7H,1-2H2,(H,12,13,14) |
| InChIKey | CEDVVFTWFUBXGG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|