C12H13FN4O — CID 156500367
(3S,5S)-5-[4-(3-fluorophenyl)-1,2,4-triazol-3-yl]pyrrolidin-3-ol (PubChem CID 156500367) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is (3S,5S)-5-[4-(3-fluorophenyl)-1,2,4-triazol-3-yl]pyrrolidin-3-ol.
| Compound Name | (3S,5S)-5-[4-(3-fluorophenyl)-1,2,4-triazol-3-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 156500367 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (3S,5S)-5-[4-(3-fluorophenyl)-1,2,4-triazol-3-yl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CN[C@H](c2nncn2-c2cccc(F)c2)C1 |
| InChI | InChI=1S/C12H13FN4O/c13-8-2-1-3-9(4-8)17-7-15-16-12(17)11-5-10(18)6-14-11/h1-4,7,10-11,14,18H,5-6H2/t10-,11-/m0/s1 |
| InChIKey | RHROXGLWFUMZPX-QWRGUYRKSA-N |
| XLogP | 0.80 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |