C31H38N4O4 — CID 156500702
3-[3-oxo-6-[[(2R)-1-[(4-piperidin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156500702) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(2R)-1-[(4-piperidin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(2R)-1-[(4-piperidin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156500702 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 3-[3-oxo-6-[[(2R)-1-[(4-piperidin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC[C@H]4CCCCN4Cc4ccc(N5CCCCC5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H38N4O4/c36-29-14-13-28(30(37)32-29)35-20-23-18-26(11-12-27(23)31(35)38)39-21-25-6-2-5-17-34(25)19-22-7-9-24(10-8-22)33-15-3-1-4-16-33/h7-12,18,25,28H,1-6,13-17,19-21H2,(H,32,36,37)/t25-,28?/m1/s1 |
| InChIKey | YMHQRQIVWNGUMS-RXVAYIKUSA-N |
| XLogP | 3.87 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|