C32H30O4 — CID 15650117
(2S,3S,3aS,5S,6S,6aS)-3,6-dimethyl-2,3a,5,6a-tetraphenyl-3,6-dihydrofuro[3,2-b]furan-2,5-diol (PubChem CID 15650117) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2S,3S,3aS,5S,6S,6aS)-3,6-dimethyl-2,3a,5,6a-tetraphenyl-3,6-dihydrofuro[3,2-b]furan-2,5-diol.
| Compound Name | (2S,3S,3aS,5S,6S,6aS)-3,6-dimethyl-2,3a,5,6a-tetraphenyl-3,6-dihydrofuro[3,2-b]furan-2,5-diol |
|---|---|
| PubChem CID | 15650117 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2S,3S,3aS,5S,6S,6aS)-3,6-dimethyl-2,3a,5,6a-tetraphenyl-3,6-dihydrofuro[3,2-b]furan-2,5-diol |
| SMILES | C[C@H]1[C@@]2(c3ccccc3)O[C@](O)(c3ccccc3)[C@@H](C)[C@@]2(c2ccccc2)O[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C32H30O4/c1-23-29(25-15-7-3-8-16-25)30(26-17-9-4-10-18-26,36-31(23,33)27-19-11-5-12-20-27)24(2)32(34,35-29)28-21-13-6-14-22-28/h3-24,33-34H,1-2H3/t23-,24-,29-,30-,31-,32-/m0/s1 |
| InChIKey | JVOQHWMKSBULGM-RRXIKBFASA-N |
| XLogP | 5.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |