C36H19F3N2O3S2 — CID 156501491
[4-(3-thia-17,32-diazaoctacyclo[15.15.0.02,14.04,13.07,12.018,31.021,30.023,28]dotriaconta-1(32),2(14),4(13),5,7,9,11,15,18(31),19,21,23,25,27,29-pentadecaen-19-yl)phenyl] trifluoromethanesulfonate (PubChem CID 156501491) has the molecular formula C36H19F3N2O3S2 and a molecular weight of 648.69 g/mol. Its IUPAC name is [4-(3-thia-17,32-diazaoctacyclo[15.15.0.02,14.04,13.07,12.018,31.021,30.023,28]dotriaconta-1(32),2(14),4(13),5,7,9,11,15,18(31),19,21,23,25,27,29-pentadecaen-19-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(3-thia-17,32-diazaoctacyclo[15.15.0.02,14.04,13.07,12.018,31.021,30.023,28]dotriaconta-1(32),2(14),4(13),5,7,9,11,15,18(31),19,21,23,25,27,29-pentadecaen-19-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156501491 |
| Molecular Formula | C36H19F3N2O3S2 |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 648.08 |
| IUPAC Name | [4-(3-thia-17,32-diazaoctacyclo[15.15.0.02,14.04,13.07,12.018,31.021,30.023,28]dotriaconta-1(32),2(14),4(13),5,7,9,11,15,18(31),19,21,23,25,27,29-pentadecaen-19-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cc3cc4ccccc4cc3c3nc4c5sc6ccc7ccccc7c6c5ccn4c23)cc1)C(F)(F)F |
| InChI | InChI=1S/C36H19F3N2O3S2/c37-36(38,39)46(42,43)44-25-12-9-21(10-13-25)29-19-24-17-22-6-1-2-7-23(22)18-28(24)32-33(29)41-16-15-27-31-26-8-4-3-5-20(26)11-14-30(31)45-34(27)35(41)40-32/h1-19H |
| InChIKey | STVWTOOFPPRACT-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|