C32H17F3N2O3S2 — CID 156501522
[4-(28-thia-3,14-diazaheptacyclo[15.11.0.02,14.04,13.05,10.018,27.019,24]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaen-15-yl)phenyl] trifluoromethanesulfonate (PubChem CID 156501522) has the molecular formula C32H17F3N2O3S2 and a molecular weight of 598.63 g/mol. Its IUPAC name is [4-(28-thia-3,14-diazaheptacyclo[15.11.0.02,14.04,13.05,10.018,27.019,24]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaen-15-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(28-thia-3,14-diazaheptacyclo[15.11.0.02,14.04,13.05,10.018,27.019,24]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaen-15-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156501522 |
| Molecular Formula | C32H17F3N2O3S2 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | [4-(28-thia-3,14-diazaheptacyclo[15.11.0.02,14.04,13.05,10.018,27.019,24]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaen-15-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cc3c(sc4ccc5ccccc5c43)c3nc4c5ccccc5ccc4n23)cc1)C(F)(F)F |
| InChI | InChI=1S/C32H17F3N2O3S2/c33-32(34,35)42(38,39)40-21-13-9-20(10-14-21)26-17-24-28-22-7-3-1-5-18(22)12-16-27(28)41-30(24)31-36-29-23-8-4-2-6-19(23)11-15-25(29)37(26)31/h1-17H |
| InChIKey | JFAFSOMVCOHNBF-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|