C28H15F3N2O3S2 — CID 156501525
[4-(3-thia-13,24-diazahexacyclo[11.11.0.02,10.04,9.014,23.017,22]tetracosa-1(24),2(10),4,6,8,11,14(23),15,17,19,21-undecaen-12-yl)phenyl] trifluoromethanesulfonate (PubChem CID 156501525) has the molecular formula C28H15F3N2O3S2 and a molecular weight of 548.57 g/mol. Its IUPAC name is [4-(3-thia-13,24-diazahexacyclo[11.11.0.02,10.04,9.014,23.017,22]tetracosa-1(24),2(10),4,6,8,11,14(23),15,17,19,21-undecaen-12-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(3-thia-13,24-diazahexacyclo[11.11.0.02,10.04,9.014,23.017,22]tetracosa-1(24),2(10),4,6,8,11,14(23),15,17,19,21-undecaen-12-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156501525 |
| Molecular Formula | C28H15F3N2O3S2 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [4-(3-thia-13,24-diazahexacyclo[11.11.0.02,10.04,9.014,23.017,22]tetracosa-1(24),2(10),4,6,8,11,14(23),15,17,19,21-undecaen-12-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cc3c4ccccc4sc3c3nc4c5ccccc5ccc4n23)cc1)C(F)(F)F |
| InChI | InChI=1S/C28H15F3N2O3S2/c29-28(30,31)38(34,35)36-18-12-9-17(10-13-18)23-15-21-20-7-3-4-8-24(20)37-26(21)27-32-25-19-6-2-1-5-16(19)11-14-22(25)33(23)27/h1-15H |
| InChIKey | WETJASQHCPSEOZ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|