C27H26FN5O2 — CID 156501611
5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)indazole-3-carboxamide (PubChem CID 156501611) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)indazole-3-carboxamide.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 156501611 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CNCC2)c1nn(C2CCCCO2)c2ccc(-c3cccnc3F)cc12 |
| InChI | InChI=1S/C27H26FN5O2/c28-26-21(4-3-11-30-26)18-7-9-23-22(15-18)25(32-33(23)24-5-1-2-13-35-24)27(34)31-20-8-6-17-10-12-29-16-19(17)14-20/h3-4,6-9,11,14-15,24,29H,1-2,5,10,12-13,16H2,(H,31,34) |
| InChIKey | IWZRHLMELAEJPX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|