C17H16BrN — CID 15650258
4-bromo-17-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10,12,14-hexaene (PubChem CID 15650258) has the molecular formula C17H16BrN and a molecular weight of 314.23 g/mol. Its IUPAC name is 4-bromo-17-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10,12,14-hexaene.
| Compound Name | 4-bromo-17-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10,12,14-hexaene |
|---|---|
| PubChem CID | 15650258 |
| Molecular Formula | C17H16BrN |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-bromo-17-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10,12,14-hexaene |
| SMILES | CN1CC2c3cc(Br)ccc3CC1c1ccccc12 |
| InChI | InChI=1S/C17H16BrN/c1-19-10-16-13-4-2-3-5-14(13)17(19)8-11-6-7-12(18)9-15(11)16/h2-7,9,16-17H,8,10H2,1H3 |
| InChIKey | OVQRWEJLPKMARV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |