About 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine (PubChem CID 156503188) has the molecular formula C16H10F6N2
and a molecular weight of 344.26 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine |
| PubChem CID | 156503188 |
| Molecular Formula | C16H10F6N2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine |
| SMILES | FC(F)(F)c1cc(Cn2ccc3cccnc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6N2/c17-15(18,19)12-6-10(7-13(8-12)16(20,21)22)9-24-5-3-11-2-1-4-23-14(11)24/h1-8H,9H2 |
| InChIKey | BPNIWZPAASOMJE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine?
The IUPAC name of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine (CID 156503188) is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine is FC(F)(F)c1cc(Cn2ccc3cccnc32)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine?
The InChIKey is BPNIWZPAASOMJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F6N2/c17-15(18,19)12-6-10(7-13(8-12)16(20,21)22)9-24-5-3-11-2-1-4-23-14(11)24/h1-8H,9H2.
What are the key properties of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine?
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine has a molecular weight of 344.26 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 156503188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).