C21H25FN2O4 — CID 156503384
3-fluoro-7-[[(1R,5R,6S,8R)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl]methyl]quinolin-2-amine (PubChem CID 156503384) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 3-fluoro-7-[[(1R,5R,6S,8R)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl]methyl]quinolin-2-amine.
| Compound Name | 3-fluoro-7-[[(1R,5R,6S,8R)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl]methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 156503384 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-fluoro-7-[[(1R,5R,6S,8R)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-yl]methyl]quinolin-2-amine |
| SMILES | CO[C@H]1O[C@@H]2C(Cc3ccc4cc(F)c(N)nc4c3)CC[C@@]23OC(C)(C)O[C@@H]13 |
| InChI | InChI=1S/C21H25FN2O4/c1-20(2)27-17-19(25-3)26-16-13(6-7-21(16,17)28-20)8-11-4-5-12-10-14(22)18(23)24-15(12)9-11/h4-5,9-10,13,16-17,19H,6-8H2,1-3H3,(H2,23,24)/t13?,16-,17+,19+,21-/m1/s1 |
| InChIKey | LMRXXNWWDHQGTR-AJOZGQBNSA-N |
| XLogP | 3.17 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |