C25H26FN5O2 — CID 156503431
(1S,2R,3aR,4S,6aR)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol (PubChem CID 156503431) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is (1S,2R,3aR,4S,6aR)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol.
| Compound Name | (1S,2R,3aR,4S,6aR)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol |
|---|---|
| PubChem CID | 156503431 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (1S,2R,3aR,4S,6aR)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C[C@@H]2[C@H](Cc3ccc4cc(F)c(N)nc4c3)CC[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C25H26FN5O2/c1-13-17-5-7-31(24(17)29-12-28-13)21-11-18-15(4-6-25(18,33)22(21)32)8-14-2-3-16-10-19(26)23(27)30-20(16)9-14/h2-3,5,7,9-10,12,15,18,21-22,32-33H,4,6,8,11H2,1H3,(H2,27,30)/t15-,18+,21+,22-,25+/m0/s1 |
| InChIKey | CKKZPYGYLPGVCZ-VCFPWYINSA-N |
| XLogP | 3.31 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |