About (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine
(2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine (PubChem CID 156503623) has the molecular formula C12H23FN2O
and a molecular weight of 230.33 g/mol. Its IUPAC name is (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine |
| PubChem CID | 156503623 |
| Molecular Formula | C12H23FN2O |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(CC2(F)CCNCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H23FN2O/c1-10-7-15(8-11(2)16-10)9-12(13)3-5-14-6-4-12/h10-11,14H,3-9H2,1-2H3/t10-,11+ |
| InChIKey | RGIVBDBUXOVODE-PHIMTYICSA-N |
| XLogP | 1.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine?
The IUPAC name of (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine (CID 156503623) is (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine.
What is the SMILES notation for (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine?
The canonical SMILES for (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine is C[C@@H]1CN(CC2(F)CCNCC2)C[C@H](C)O1.
What is the InChIKey of (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine?
The InChIKey is RGIVBDBUXOVODE-PHIMTYICSA-N. The full InChI is InChI=1S/C12H23FN2O/c1-10-7-15(8-11(2)16-10)9-12(13)3-5-14-6-4-12/h10-11,14H,3-9H2,1-2H3/t10-,11+.
What are the key properties of (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine?
(2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine has a molecular weight of 230.33 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-4-[(4-fluoropiperidin-4-yl)methyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 156503623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).