About 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one
5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 15650363) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 15650363 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2c(c1O)CCC(=O)N2 |
| InChI | InChI=1S/C11H13NO2/c1-6-5-7(2)11(14)8-3-4-9(13)12-10(6)8/h5,14H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | LTZONHFITLMJLB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one (CID 15650363) is 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one is Cc1cc(C)c2c(c1O)CCC(=O)N2.
What is the InChIKey of 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is LTZONHFITLMJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-6-5-7(2)11(14)8-3-4-9(13)12-10(6)8/h5,14H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one?
5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 191.23 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6,8-dimethyl-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 15650363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).