C23H18F5N3O3 — CID 156504288
N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide (PubChem CID 156504288) has the molecular formula C23H18F5N3O3 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 156504288 |
| Molecular Formula | C23H18F5N3O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide |
| SMILES | CN(C(=O)N1Cc2ccc(C(F)(F)F)cc2C1)C1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C23H18F5N3O3/c1-30(22(33)31-7-11-2-3-13(23(26,27)28)4-12(11)8-31)19-10-34-9-18-20(19)14-5-16(24)17(25)6-15(14)21(32)29-18/h2-6,19H,7-10H2,1H3,(H,29,32) |
| InChIKey | QRAHHLFSYHCPJN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |