C18H14Cl2FN7O — CID 156504829
1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]azetidin-1-yl]prop-2-en-1-one (PubChem CID 156504829) has the molecular formula C18H14Cl2FN7O and a molecular weight of 434.26 g/mol. Its IUPAC name is 1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156504829 |
| Molecular Formula | C18H14Cl2FN7O |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Nc2ncc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3n2)C1 |
| InChI | InChI=1S/C18H14Cl2FN7O/c1-2-13(29)28-6-9(7-28)25-18-22-5-12-16(27-18)17(24-8-23-12)26-11-4-3-10(19)14(20)15(11)21/h2-5,8-9H,1,6-7H2,(H,22,25,27)(H,23,24,26) |
| InChIKey | WYZFUWVSNZSSCP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|