C21H19Cl2FN6O — CID 156504919
1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]-3-ethylazetidin-1-yl]prop-2-en-1-one (PubChem CID 156504919) has the molecular formula C21H19Cl2FN6O and a molecular weight of 461.33 g/mol. Its IUPAC name is 1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]-3-ethylazetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]-3-ethylazetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156504919 |
| Molecular Formula | C21H19Cl2FN6O |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-[3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]-3-ethylazetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(CC)(Nc2ccc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3n2)C1 |
| InChI | InChI=1S/C21H19Cl2FN6O/c1-3-16(31)30-9-21(4-2,10-30)29-15-8-7-14-19(28-15)20(26-11-25-14)27-13-6-5-12(22)17(23)18(13)24/h3,5-8,11H,1,4,9-10H2,2H3,(H,28,29)(H,25,26,27) |
| InChIKey | PZEGNDJMSMUJFE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|