C16H14Cl2FN7 — CID 156504949
4-N-(3,4-dichloro-2-fluorophenyl)-6-N-[(3S)-pyrrolidin-3-yl]pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 156504949) has the molecular formula C16H14Cl2FN7 and a molecular weight of 394.24 g/mol. Its IUPAC name is 4-N-(3,4-dichloro-2-fluorophenyl)-6-N-[(3S)-pyrrolidin-3-yl]pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-dichloro-2-fluorophenyl)-6-N-[(3S)-pyrrolidin-3-yl]pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 156504949 |
| Molecular Formula | C16H14Cl2FN7 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 4-N-(3,4-dichloro-2-fluorophenyl)-6-N-[(3S)-pyrrolidin-3-yl]pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | Fc1c(Nc2ncnc3cnc(N[C@H]4CCNC4)nc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C16H14Cl2FN7/c17-9-1-2-10(13(19)12(9)18)25-15-14-11(22-7-23-15)6-21-16(26-14)24-8-3-4-20-5-8/h1-2,6-8,20H,3-5H2,(H,21,24,26)(H,22,23,25)/t8-/m0/s1 |
| InChIKey | TZEUOWRATXBPNO-QMMMGPOBSA-N |
| XLogP | 3.38 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|