C23H24Cl2FN5O2 — CID 156505074
tert-butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 156505074) has the molecular formula C23H24Cl2FN5O2 and a molecular weight of 492.38 g/mol. Its IUPAC name is tert-butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156505074 |
| Molecular Formula | C23H24Cl2FN5O2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | tert-butyl 3-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2ccc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3n2)C1 |
| InChI | InChI=1S/C23H24Cl2FN5O2/c1-23(2,3)33-22(32)31-9-8-13(11-31)10-14-4-6-17-20(29-14)21(28-12-27-17)30-16-7-5-15(24)18(25)19(16)26/h4-7,12-13H,8-11H2,1-3H3,(H,27,28,30) |
| InChIKey | QCDLQHFCSVOITA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|