C15H11Cl2FN4O2S — CID 156505157
N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 156505157) has the molecular formula C15H11Cl2FN4O2S and a molecular weight of 401.25 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156505157 |
| Molecular Formula | C15H11Cl2FN4O2S |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2nc1S(C)(=O)=O |
| InChI | InChI=1S/C15H11Cl2FN4O2S/c1-7-5-10-13(22-15(7)25(2,23)24)14(20-6-19-10)21-9-4-3-8(16)11(17)12(9)18/h3-6H,1-2H3,(H,19,20,21) |
| InChIKey | JSZLTAVHFKZUSH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|