About N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine
N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 156505157) has the molecular formula C15H11Cl2FN4O2S
and a molecular weight of 401.25 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 156505157 |
| Molecular Formula | C15H11Cl2FN4O2S |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2nc1S(C)(=O)=O |
| InChI | InChI=1S/C15H11Cl2FN4O2S/c1-7-5-10-13(22-15(7)25(2,23)24)14(20-6-19-10)21-9-4-3-8(16)11(17)12(9)18/h3-6H,1-2H3,(H,19,20,21) |
| InChIKey | JSZLTAVHFKZUSH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine (CID 156505157) is N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine is Cc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2nc1S(C)(=O)=O.
What is the InChIKey of N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is JSZLTAVHFKZUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2FN4O2S/c1-7-5-10-13(22-15(7)25(2,23)24)14(20-6-19-10)21-9-4-3-8(16)11(17)12(9)18/h3-6H,1-2H3,(H,19,20,21).
What are the key properties of N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine?
N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 401.25 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dichloro-2-fluorophenyl)-7-methyl-6-methylsulfonylpyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 156505157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).